2-Bromo-3-nitrobenzoic acid
2-Bromo-3-nitrobenzoic Acid acts as a reagent for the synthesis and in the anticancer activity of dendrodolides A-D and their ester analogs. Also acts as a reagent for the preparation of bromophenazine antibacterial agents against Staphylococcus aureus and Staphylococcus epidermidis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 573-54-6 |
| Pricing | Inquire |
| Cas | 573-54-6 |
| Molecular Weight | 246.01 |
| Molecular Formula | C7H4BrNO4 |
| Canonical SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)C(=O)O |