Tolvaptan-[d7]
Tolvaptan-[d7] is the labelled analogue of Tolvaptan, which has been found to be a vasopressin V2 receptor antagonist and could probably be effective against hypertensive heart failure and could also be an effective renal protective agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-014026 |
| Pricing | Inquire |
| Cas | 1246818-18-7 |
| Molecular Weight | 455.98 |
| Molecular Formula | C26H18D7ClN2O3 |
| Canonical SMILES | CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)N3CCCC(C4=C3C=CC(=C4)Cl)O)C |