5-Bromoisatoic anhydride
5-Bromoisatoic anhydride is an intriguing chemical compound extensively employed in the biomedical industry and manifests tremendous potential in synthesizing pharmaceutical drugs and unraveling the intricate mechanisms of diverse diseases. By virtue of its distinctive structural properties and unmatched reactivity, this compound has emerged as a pivotal intermediate in the realm of pharmaceutical synthesis, presenting promising avenues for targeted therapeutics against specific maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4692-98-2 |
| Pricing | Inquire |
| Cas | 4692-98-2 |
| Molecular Weight | 242.02 |
| Molecular Formula | C8H4BrNO3 |
| Canonical SMILES | C1=CC2=C(C=C1Br)C(=O)OC(=O)N2 |