Octyl 2-acetamido-2-deoxy-b-D-galactopyranoside
Octyl 2-acetamido-2-deoxy-b-D-galactopyranoside is a vital component used in biomedicine. Widely employed as a detergent, it aids in the isolation and manipulation of proteins and biomolecules for research purposes. Its unique properties make it an effective tool in drug discovery, particularly in studying membrane proteins and glycoprotein structures.
| Supplier | BOC Sciences |
|---|---|
| Product # | 383417-49-0 |
| Pricing | Inquire |
| Cas | 383417-49-0 |
| Molecular Weight | 333.42 |
| Molecular Formula | C16H31NO6 |
| Canonical SMILES | CCCCCCCCOC1C(C(C(C(O1)CO)O)O)NC(=O)C |