cyclo(L-Pro-L-Tyr)
cyclo(L-Pro-L-Tyr) is a diketopiperazine formed by the fusion of tyrosine and proline, and is a secondary metabolite of fungi and bacteria. It can activate N-acyl homoserine lactone (ahls), and can also activate or counteract other luxr-based quorum sensing systems.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015108 |
| Pricing | Inquire |
| Cas | 4549-02-4 |
| Molecular Weight | 260.29 |
| Molecular Formula | C14H16N2O3 |
| Canonical SMILES | C1CC2C(=O)NC(C(=O)N2C1)CC3=CC=C(C=C3)O |