Naphthol AS-OL acetate
Naphthol AS-OL acetate is an indispensable biomedical compound acting as an intermediate, skillfully orchestrating the synthesis of a diverse array of drugs specifically tailored to study multifarious ailments, including cancer, inflammation and microbial infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7128-79-2 |
| Pricing | Inquire |
| Cas | 7128-79-2 |
| Molecular Weight | 335.4 |
| Molecular Formula | C20H17NO4 |
| Canonical SMILES | CC(=O)OC1=CC2=CC=CC=C2C=C1C(=O)NC3=CC=CC=C3OC |