N-Debenzoyl-7-{[(2,2,2,-trichloroethyl)oxy]carbonyl} Paclitaxel
N-Debenzoyl-7-{[(2,2,2,-trichloroethyl)oxy]carbonyl} Paclitaxel is one of Paclitaxel impurities. Paclitaxel is a tetracyclic diterpenoid isolated originally from the Pacific yew tree Taxus brevifolia. It is a mitotic inhibitor used in cancer chemotherapy. It has a role as a microtubule-stabilising agent, a metabolite, a human metabolite and an antineoplastic agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114915-15-0 |
| Pricing | Inquire |
| Cas | 114915-15-0 |
| Molecular Weight | 925.20 |
| Molecular Formula | C43H48Cl3NO15 |
| Canonical SMILES | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)N)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)OC(=O)OCC(Cl)(Cl)Cl)C)OC(=O)C |