Phentolamine acetate
Phentolamine is a reversible nonselective α-adrenergic antagonist that is only indicated in the specific setting of acute hypertensive crises secondary to excess circulating catecholamines from a pheochromocytoma, or reactions involving a monoamine oxidase inhibitor.
| Supplier | BOC Sciences |
|---|---|
| Product # | 249607-96-3 |
| Pricing | Inquire |
| Cas | 249607-96-3 |
| Molecular Weight | 341.40 |
| Molecular Formula | C17H19N3O.C2H4O2 |
| Canonical SMILES | CC1=CC=C(C=C1)N(CC2=NCCN2)C3=CC(=CC=C3)O.CC(=O)O |