b-D-Fructofuranosyl a-D-glucopyranoside 6-octanoate
b-D-Fructofuranosyl a-D-glucopyranoside 6-octanoate, known for its biomedical utility, presents a compelling avenue for addressing diverse afflictions. Its manifold benefits, including potent anti-inflammatory and antioxidant attributes, render it an auspicious candidate for tackling maladies like arthritis and cardiovascular conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13039-39-9 |
| Pricing | Inquire |
| Cas | 13039-39-9 |
| Molecular Weight | 468.5 |
| Molecular Formula | C20H36O12 |
| Canonical SMILES | CCCCCCCC(=O)OCC1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O |