2'-Deoxyguanosine-5'-carboxylic acid
2'-Deoxyguanosine-5'-carboxylic acid, an indispensable compound in the biomedical sector, exhibits profound significance in the realm of DNA synthesis and repair. Its pivotal role renders it a commendable instrument in unraveling the intricacies of DNA damage and repair mechanisms. Furthermore, this compound contributes to the advancement of therapeutic medications, specifically targeting afflictions like cancer and viral infections. The multifaceted nature of its applications bestows upon it an irreplaceable value, enhancing the landscape of biomedical research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 82534-56-3 |
| Pricing | Inquire |
| Cas | 82534-56-3 |
| Molecular Weight | 281.23 |
| Molecular Formula | C10H11N5O5 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)C(C(=O)O)O)O |