1-[10-[2-(Dimethylamino)-1-methylethyl]-10H-phenothiazin-3-yl]-1-propanone hydrochloride
1-[10-[2-(Dimethylamino)-1-methylethyl]-10H-phenothiazin-3-yl]-1-propanone hydrochloride is an extensively utilized pharmaceutical compound within the biomedical industry manifesting its remarkable competence in studying an array of ailments such as psychiatric disorders, notably schizophrenia and bipolar disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | 64-89-1 |
| Pricing | Inquire |
| Cas | 64-89-1 |
| Molecular Weight | 376.95 |
| Molecular Formula | C20H25ClN2OS |
| Canonical SMILES | CCC(=O)C1=CC2=C(C=C1)N(C3=CC=CC=C3S2)C(C)CN(C)C.Cl |