XMU-MP-3
XMU-MP-3 is a potent inhibitor of non-covalent BTK with IC50s of 10.7 nM and 17.0 nM for BTK WT and BTK C481S mutation in the presence of 10 μM ATP, respectively. XMU-MP-3 also induces apoptosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2031152-08-4 |
| Pricing | Inquire |
| Cas | 2031152-08-4 |
| Molecular Weight | 536.55 |
| Molecular Formula | C27H27F3N8O |
| Canonical SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)C(F)(F)F)N3CC4=CN=C(N=C4N(C3)C)NC5=CC(=NN5C)C |