Indole-5-carboxylic acid
Indole-5-carboxylic acid (CAS# 1670-81-1) is used in the synthesis of selective D3 dopamine receptor agonists used to combat diseases such as Parkinson's. Also used in the preparation of potent ligand-efficient inhibitors of CTM-X Class A β-Lactamases which pose health threats to the public.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1670-81-1 |
| Pricing | Inquire |
| Cas | 1670-81-1 |
| Molecular Weight | 161.16 |
| Molecular Formula | C9H7NO2 |
| Canonical SMILES | C1=CC2=C(C=CN2)C=C1C(=O)O |