2-Chloro-N-[(3-iodophenyl)methyl]-2',3'-O-(1-methylethylidene) Adenosine
2-Chloro-N-[(3-iodophenyl)methyl]-2',3'-O-(1-methylethylidene) Adenosine, a potent inhibitor of adenosine deaminase, exhibits anti-inflammatory and antitumor activity. Its use in research probes underexplored mechanisms that underlie various clinical conditions, and its therapeutic prospects extend to treating autoimmune disorders and cancers.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1000980-71-1 |
| Pricing | Inquire |
| Cas | 1000980-71-1 |
| Molecular Weight | 557.77 |
| Molecular Formula | C20H21ClIN5O4 |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=NC4=C(N=C(N=C43)Cl)NCC5=CC(=CC=C5)I)CO)C |