2-Fluoro-3-(trifluoromethyl)benzoic acid
2-Fluoro-3-(trifluoromethyl)benzoic acid (CAS# 115029-22-6) is a building block used for the synthesis of more complex pharmaceutical and biologically active compounds. It is used for the preparation of SGA360 (S282200), a selective modulator of aryl hydrocarbon (Ah) receptor activity that exhibits anti-inflammatory properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 115029-22-6 |
| Pricing | Inquire |
| Cas | 115029-22-6 |
| Molecular Weight | 208.11 |
| Molecular Formula | C8H4F4O2 |
| Canonical SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)O |