5'-O-DMT-inosine
5'-O-DMT-inosine is also known as 5'-O-dimethoxytrityl inosine, beholding immense significance primarily in the realm of nucleotide and nucleoside research. Notably, its profound properties have positioned it as a crucial catalyst in the intricate process of formulating cutting-edge antiviral medications .
| Supplier | BOC Sciences |
|---|---|
| Product # | 119898-59-8 |
| Pricing | Inquire |
| Cas | 119898-59-8 |
| Molecular Weight | 570.59 |
| Molecular Formula | C31H30N4O7 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=NC6=C5N=CNC6=O)O)O |