PPIase-Parvulin Inhibitor
PPIase-Parvulin Inhibitor is a cell-permeable inhibitor of the PPIases Pin1 and Pin4 (IC50s = 1.5 and 1.0 µM, respectively). It blocks the proliferation of cancer cells that overexpress Pin1 and Pin4 (IC50 = 2-5 µM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 64005-90-9 |
| Pricing | Inquire |
| Cas | 64005-90-9 |
| Molecular Weight | 438.4 |
| Molecular Formula | C22H18N2O8 |
| Canonical SMILES | CCOC(=O)CN1C(=O)C2=C3C(=CC=C4C3=C(C=C2)C(=O)N(C4=O)CC(=O)OCC)C1=O |