2-Methoxycarbonylphenyl b-D-glucopyranoside
2-Methoxycarbonylphenyl b-D-glucopyranoside, a versatile compound, occupies a significant position in biomedicine owing to its proficiency in probing carbohydrate metabolism and its implications in diabetes research. This chemical entity emerges as an indispensable tool in scrutinizing glucose transporters and enzymes involved in the intricate glucose-related processes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10019-60-0 |
| Pricing | Inquire |
| Cas | 10019-60-0 |
| Molecular Weight | 314.29 |
| Molecular Formula | C14H18O8 |
| Canonical SMILES | COC(=O)C1=CC=CC=C1OC2C(C(C(C(O2)CO)O)O)O |