2'-O-tert-Butyldimethylsilyl-5-methyluridine
2'-O-tert-Butyldimethylsilyl-5-methyluridine standing as an essential entity wielded within the biomedical realm to orchestrate the research and development of nucleoside analogs. Rendering itself instrumental in crafting antiviral medications and providing a foundational cornerstone for tackling an assortment of viral afflictions, this compound exhibiting indomitably consequential characteristics that have propelled it towards the forefront of pharmaceutical research and development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 922508-26-7 |
| Pricing | Inquire |
| Cas | 922508-26-7 |
| Molecular Weight | 372.49 |
| Molecular Formula | C16H28N2O6Si |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O[Si](C)(C)C(C)(C)C |