2-Deoxy-2-fluoro-b-D-glucopyranosyl azide
2-Deoxy-2-fluoro-b-D-glucopyranosyl azide is a multifaceted biomedical marvel, assuming a pivotal position in the realm of carbohydrate chemistry, particularly within the domain of glycosylation reactions' progression. Functioning as an extraordinarily adaptable compound, it bestows upon us the ability to synthesize an array of bioactive compounds and pharmaceuticals. Such a compound thrives in labeling and imaging studies, additionally fostering the synthesis of glycoconjugate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1159265-95-8 |
| Pricing | Inquire |
| Cas | 1159265-95-8 |
| Molecular Weight | 207.16 |
| Molecular Formula | C6H10FN3O4 |
| Canonical SMILES | C(C1C(C(C(C(O1)N=[N+]=[N-])F)O)O)O |