Geneticin sulfate
Geneticin sulfate is an aminoglycoside antibiotic originally derived from Micromonospora rhodorangea. Geneticin blocks polypeptide synthesis by inhibiting the elongation step in both prokaryotic and eukaryotic cells. It is an inhibitor of many prokaryotes and eukaryotes at concentrations from 1-300 mg/ml.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03794 |
| Pricing | Inquire |
| Cas | 108321-42-2 |
| Molecular Weight | 692.71 |
| Molecular Formula | C20H44N4O18S2 |
| Canonical SMILES | CC(C1C(C(C(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)O)O)O.OS(=O)(=O)O.OS(=O)(=O)O |