2-(Di-t-butylphosphinomethyl)-6-(diethylaminomethyl)pyridine,98%
2-(Di-t-butylphosphinomethyl)-6-(diethylaminomethyl)pyridine,98% embodies a distinct pharmaceutical compound, routinely encompassed within antiviral drug formulations. It plays an important role in inhibiting viral replication and is primarily studied in pathological conditions such as hepatitis C and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 863971-66-8 |
| Pricing | Inquire |
| Cas | 863971-66-8 |
| Molecular Weight | 322.47 |
| Molecular Formula | C19H35N2P |
| Canonical SMILES | CCN(CC)CC1=NC(=CC=C1)CP(C(C)(C)C)C(C)(C)C |