Allyl b-D-galactopyranoside
Allyl b-D-galactopyranoside is a chemical compound commonly used in the biomedical industry. It exhibits potential antimicrobial and anti-inflammatory properties, making it a valuable ingredient for drugs targeting bacterial infections and inflammatory diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2595-07-5 |
| Pricing | Inquire |
| Cas | 2595-07-5 |
| Molecular Weight | 220.22 |
| Molecular Formula | C9H16O6 |
| Canonical SMILES | C=CCOC1C(C(C(C(O1)CO)O)O)O |