3-O-β-D-Glucopyranosyl Alternariol-9-methyl Ether
3-O-β-D-Glucopyranosyl Alternariol-9-methyl Ether is a derivative of Alternariol which is an alternaria mycotoxin and genotoxin, found in common edible crops. Alternariol inhibits the activity of various DNA-topoisomerases, increasing the rate of DNA strand breaks. Alternariol 3-Sulfate Ammonium Salt is currently suspected of being formed during metabolism in contaminated plants.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1422465-59-5 |
| Pricing | Inquire |
| Cas | 1422465-59-5 |
| Molecular Weight | 434.39 |
| Molecular Formula | C21H22O10 |
| Canonical SMILES | CC1=CC(=CC2=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)OC4C(C(C(C(O4)CO)O)O)O |