4- [(1, 3- Dihydro- 1- hydroxy- 2, 1- benzoxaborol- 5- yl) oxy] -benzamide
4- [(1, 3- Dihydro- 1- hydroxy- 2, 1- benzoxaborol- 5- yl) oxy] -benzamide is used in the preparation of substituted benzoxaborole and related boron-containing small molecules as anti-inflammatory agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB068663 |
| Pricing | Inquire |
| Cas | 1187188-59-5 |
| Molecular Weight | 269.06 |
| Molecular Formula | C14H12BNO4 |
| Canonical SMILES | B1(C2=C(CO1)C=C(C=C2)OC3=CC=C(C=C3)C(=O)N)O |