Dovitinib lactate
Dovitinib, also referred as CHIR-258 or TKI258, is a potent receptor tyrosine kinase inhibitor (TKI) that selectively targets VEGFR, PDGFR, FGFR, CSF1R, c-KIT, RET, TrKA, and FLT3, and additionally targets FGFR (IC50 = 5 nM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 692737-80-7 |
| Pricing | Inquire |
| Cas | 692737-80-7 |
| Molecular Weight | 482.51 |
| Molecular Formula | C24H27FN6O4 |
| Canonical SMILES | CC(C(=O)O)O.CN1CCN(CC1)C2=CC3=C(C=C2)NC(=C4C(=C5C(=NC4=O)C=CC=C5F)N)N3 |