Tylosin EP Impurity EE
Tylosin EP Impurity EE is an impurity of Tylosin, which is a macrolide antibiotic and bacteriostatic feed additive used in veterinary medicine with broad-spectrum activity against gram-positive bacteria and limited activity against gram-negative bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 950171-77-4 |
| Pricing | Inquire |
| Cas | 950171-77-4 |
| Molecular Weight | 916.11 |
| Molecular Formula | C46H77NO17 |
| Canonical SMILES | CCC1C(C=C(C=CC(=O)C(CC(C(C(C(CC(=O)O1)O)C)OC2C(C(C(C(O2)C)OC3CC(C(C(O3)C)O)(C)O)N(C)C)O)CC=O)C)C)COC4C(C(C(C(O4)C)O)OC)OC |