alpha-GalNAc-N3
alpha-GalNAc-N3, a prominent biomedicine extensively utilized in the pharmaceutical industry, stands as an indispensable chemical probe or precursor for synthesizing glycan-modified biomolecules. Boasting the remarkable attribute of azide functionality, it offers a powerful avenue to incorporate GalNAc moieties into targeted glycoproteins.
| Supplier | BOC Sciences |
|---|---|
| Product # | 195384-42-0 |
| Pricing | Inquire |
| Cas | 195384-42-0 |
| Molecular Weight | 290.27 |
| Molecular Formula | C10H18N4O6 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OCCN=[N+]=[N-])CO)O)O |