Melphalan Impurity 2
L-3-Nitrophenylalanine is a derivative of L-Phenylalanine, and is used in the photocleavage of polypeptide backbones. L-Phenylalanine is an essential amino acid. L-Phenylalanine is biologically converted into L-tyrosine, another one of the DNA-encoded ami
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-008058 |
| Pricing | Inquire |
| Cas | 19883-74-0 |
| Molecular Weight | 210.19 |
| Molecular Formula | C9H10N2O4 |
| Canonical SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CC(C(=O)O)N |