20-Hydroxyecdysone
20-Hydroxyecdysone (ecdysterone or 20E) is a naturally occurring ecdysteroid hormone which controls the ecdysis (moulting) and metamorphosis of arthropods. It is therefore one of the most common moulting hormones in insects, crabs, etc. 20-Hydroxyecdysone can be used in cosmetics material.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-345019 |
| Pricing | 1 g/unit USD $176 |
| Cas | 5289-74-7 |
| Molecular Weight | 480.63 |
| Molecular Formula | C27H44O7 |
| Canonical SMILES | CC12CCC3C(=CC(=O)C4C3(CC(C(C4)O)O)C)C1(CCC2C(C)(C(CCC(C)(C)O)O)O)O |