Poly(D,L-lactide-block-acrylic acid)
| Supplier | CD Formulation |
|---|---|
| Product # | MSMN-102 |
| Pricing | 1 g in glass bottle, Inquire for price |
| product1 | Polymers |
| Administration route | This diblock copolymer can be used to self-assemble into a drug delivery vehicle. This particular block ratio and molecular weight forms spherical micelles. |
| Molecular Formula | C13H25S3(C3H4O2)xC6H9NO(C3H4O2)yH |
| Purity | PDLLA -b-PAA 5kDa, PLA-PAA, Polylactide-block-polyacrylic acid |