Etoposide EP Impurity B
An impurity of Etoposide. Etoposide is a cytotoxic anticancer drug which belongs to the topoisomerase inhibitor drug class. It is used in form of its salt etoposide phosphate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100007-56-5 |
| Pricing | Inquire |
| Cas | 100007-56-5 |
| Molecular Weight | 588.57 |
| Molecular Formula | C29H32O13 |
| Canonical SMILES | CC1OCC2C(O1)C(C(C(O2)OC3C4COC(=O)C4C(C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)O)OC)O)O |