5-Fluoroorotic acid
5-Fluoroorotic, a selective agent in yeast molecular genetics, is used to select orotidine-5'-phosphate decarboxylase mutants of Saccharomyces cerevisiae. It has well-expressed anticandida effects similar to 5-fluorocytosine, as well as moderate antidermatophytal effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 703-95-7 |
| Pricing | Inquire |
| Cas | 703-95-7 |
| Molecular Weight | 174.09 |
| Molecular Formula | C5H3FN2O4 |
| Canonical SMILES | C1(=C(NC(=O)NC1=O)C(=O)O)F |