5-Methoxy-3-pyridineboronic Acid Pinacol Ester
5-Methoxy-3-pyridineboronic acid pinacol ester can be used: To synthesize anthracene based bis-pyridine ligand (L), which is employed in the preparation of fluorescent M2L4 type capsules (M= Pt, Zn, Pd, Cu, Ni, Co, and Mn); As a starting material in the synthesis of pyridylmethyl pyridine derivatives as potent 11β-hydroxylase (CPY11B1) inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB025633 |
| Pricing | Inquire |
| Cas | 445264-60-8 |
| Molecular Weight | 235.09 |
| Molecular Formula | C12H18NO3B |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)OC |