6-Methoxynaphth-1-yl trifluoromethanesulfonate
6-Methoxynaphth-1-yl trifluoromethanesulfonate is a useful synthetic intermediate. It is used to prepare analogs of GW 4064 with FXR agonists. It is also used to synthesize arylpiperazinylethylthienopyrancarboxamides as selective and potent 5-HT reuptake inhibitors with 5-HT1D antagonist activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB076159 |
| Pricing | Inquire |
| Cas | 350584-53-1 |
| Molecular Weight | 306.26 |
| Molecular Formula | C12H9F3O4S |
| Canonical SMILES | COC1=CC2=C(C=C1)C(=CC=C2)OS(=O)(=O)C(F)(F)F |