3'-O-(2-Methoxyethyl)adenosine
3'-O-(2-Methoxyethyl)adenosine, renowned in the biomedical industry, holds immense significance for a myriad of applications. With its pivotal role in the pharmaceutical realm, it contributes significantly in the combat against afflictions like cancer, viral infections, and inflammation. By orchestrating cellular pathways and regulating biological processes, this compound manifests promising therapeutic effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 303197-30-0 |
| Pricing | Inquire |
| Cas | 303197-30-0 |
| Molecular Weight | 325.32 |
| Molecular Formula | C13H19N5O5 |
| Canonical SMILES | COCCOC1C(OC(C1O)N2C=NC3=C(N=CN=C32)N)CO |