Astragaloside IV
Astragaloside IV is extracted from roots of Astragalus membranaceus (Fisch.) Bunge. It has anti-aging properties, antioxidant, anti-inflammatory and anti-fibrotic effects in systemic sclerosis. It inhibits migration and invasion in human lung cancer A549 cells via regulating PKC-α-ERK1/2-NF-κB pathway. Astragaloside IV is a natural compound used in cosmetics material.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6997 |
| Pricing | Inquire |
| Cas | 84687-43-4 |
| Molecular Weight | 784.97 |
| Molecular Formula | C41H68O14 |
| Canonical SMILES | CC1(C(CCC23C1C(CC4C2(C3)CCC5(C4(CC(C5C6(CCC(O6)C(C)(C)O)C)O)C)C)OC7C(C(C(C(O7)CO)O)O)O)OC8C(C(C(CO8)O)O)O)C |