[5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate
[5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate is an organic compound that is commonly used in the development of drugs for the treatment of various diseases - some of which include cancer and certain viral infections. By targeting specific disease-causing agents, the compound has shown tremendous promise in biomedicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7057-46-7 |
| Pricing | Inquire |
| Cas | 7057-46-7 |
| Molecular Weight | 532.47 |
| Molecular Formula | C26H23F3N2O7 |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)OCC2C(CC(O2)N3C=C(C(=O)NC3=O)C(F)(F)F)OC(=O)C4=CC=C(C=C4)C |