Cloxacillin Sodium Salt
Cloxacillin is an antibiotic that belongs to the group of the isoxazolylpenicillins. Cloxacillin is used to treat infections caused by species of staphylococci that produce beta-lactamase due to its inhibitory effects on beta-lactamase binding.
| Supplier | BOC Sciences |
|---|---|
| Product # | 642-78-4 |
| Pricing | Inquire |
| Cas | 642-78-4 |
| Molecular Weight | 457.86 |
| Molecular Formula | C19H17ClN3O5SNa |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)NC3C4N(C3=O)C(C(S4)(C)C)C(=O)[O-].O.[Na+] |