Fmoc-Asp(OtBu)-OH-[13C4,15N]
Fmoc-Asp(OtBu)-OH-[13C4,15N] is an isotope labelled of Fmoc-Asp(OtBu)-OH. L-Aspartic acid is a non-essential amino acid that is used to biosynthesize other amino acids within the human body. Fmoc-L-aspartic Acid β-tert-butyl Ester is a Fmoc protected L-Aspartic Acid 4-tert-Butyl Ester, which is a protected form of L-Aspartic acid.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004500 |
| Pricing | Inquire |
| Cas | 387867-74-5 |
| Molecular Weight | 416.41 |
| Molecular Formula | C19[13C]4H25[15N]O6 |
| Canonical SMILES | CC(C)(C)OC(=O)CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |