2',3',5'-Tri-O-acetyl-5-hydroxymethyluridine
2',3',5'-Tri-O-acetyl-5-hydroxymethyluridine, an indispensable compound in the realm of biomedicine, finds widespread applications. Its utilization in drug development to construct antiviral agents combating RNA virus-induced afflictions is noteworthy. It plays a pivotal role in the synthesis of nucleoside analogues, which exhibit therapeutic potential against viral infections and select malignancies. The accessibility of this compound guarantees the production of indispensable pharmaceutical interventions for enhanced patient care and well-being.
| Supplier | BOC Sciences |
|---|---|
| Product # | 285549-57-7 |
| Pricing | Inquire |
| Cas | 285549-57-7 |
| Molecular Weight | 400.34 |
| Molecular Formula | C16H20N2O10 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2CC(C(=O)NC2=O)CO)OC(=O)C)OC(=O)C |