2-Acetamido-6-chloro-9-(2',3',5'-tri-O-acetyl-β-D-ribofuranosyl)purine
2-Acetamido-6-chloro-9-(2',3',5'-tri-O-acetyl-β-D-ribofuranosyl)purine is a remarkable antiviral compound, showing potential in combating a range of viral infections. By impeding viral replication and augmenting immune responses, this compound manifests as a promising tool against afflictions caused by herpes simplex virus and human immunodeficiency virus (HIV).
| Supplier | BOC Sciences |
|---|---|
| Product # | 137896-02-7 |
| Pricing | Inquire |
| Cas | 137896-02-7 |
| Molecular Weight | 469.83 |
| Molecular Formula | C18H20ClN5O8 |
| Canonical SMILES | CC(=O)NC1=NC2=C(C(=N1)Cl)N=CN2C3C(C(C(O3)COC(=O)C)OC(=O)C)OC(=O)C |