3-Hydroxymethyl-pyrrolidine-1-carboxylic acid tert-butyl ester
3-Hydroxymethyl-pyrrolidine-1-carboxylic acid tert-butyl ester (CAS# 114214-69-6) is an intermediate of SR 9009 (S684255). SR 9009 is a synthetic REV-ERB agonist that regulates circadian behavior and metabolism; has potential use in the treatment of sleep disorders and metabolic diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114214-69-6 |
| Pricing | Inquire |
| Cas | 114214-69-6 |
| Molecular Weight | 201.26 |
| Molecular Formula | C10H19NO3 |
| Canonical SMILES | CC(C)(C)OC(=O)N1CCC(C1)CO |