8-Amino-3,4-dihydro-2-methyl-1(2H)-isoquinolinone
An alternative microwave-assisted synthesis of 8-Amino-3,4-dihydro-2-methyl-1(2H)-isoquinolinone has been examined. The synthesis includes two one- pot procedures in which the key process involves the microwave- assisted hydrolysis of a nitrile group followed by lactamization under elevated temps.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB054986 |
| Pricing | Inquire |
| Cas | 878155-22-7 |
| Molecular Weight | 176.22 |
| Molecular Formula | C10H12N2O |
| Canonical SMILES | CN1CCC2=C(C1=O)C(=CC=C2)N |