H 89 2HCl
H 89 2HCl is a cell permeable and potent PKA inhibitor with Ki of 48 nM in a cell-free assay, wihich is 10-fold selective for PKA than PKG, 500-fold greater selectivity than PKC, MLCK, calmodulin kinase II and casein kinase I/II.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-360949 |
| Pricing | Inquire |
| Cas | 130964-39-5 |
| Molecular Weight | 519.28 |
| Molecular Formula | C20H20BrN3O2S·2HCl |
| Canonical SMILES | C1=CC2=C(C=CN=C2)C(=C1)S(=O)(=O)NCCNCC=CC3=CC=C(C=C3)Br.Cl.Cl |