6-Thio-GMP
6-Thio-GMP, a bioactive compound employed for biomedical research, demonstrates inhibitory effects on numerous tumors, rendering it a prospective therapeutic intervention for leukemia and lymphoma. Moreover, it displays antiviral capability as validated by its potency to inhibit replication of viruses such as Ebola virus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15867-02-4 |
| Pricing | Inquire |
| Cas | 15867-02-4 |
| Molecular Weight | 379.28 (free acid) |
| Molecular Formula | C10H14N5O7PS (free acid) |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)O)O)O)NC(=NC2=S)N |