Tyrocidine C hydrochloride
Tyrocidine C is a peptide antibiotic originally isolated from Bac. brevis. It is resistant to gram-positive bacteria and protozoa as well as to a lesser degree to gram-negative bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02733 |
| Pricing | Inquire |
| Cas | 28343-15-9 |
| Molecular Weight | 1385.01 |
| Molecular Formula | C70H90ClN15O13 |
| Canonical SMILES | CC(C)CC1C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCN)C(C)C)CC3=CC=C(C=C3)O)CCC(=O)N)CC(=O)N)CC4=CNC5=CC=CC=C54)CC6=CNC7=CC=CC=C76)CC8=CC=CC=C8.Cl |