Naphthol AS-TR phosphate
Naphthol AS-TR phosphate is an indispensable compound prevalent in the biomedical sector, serving as a substrate for distinct enzyme assays, particularly those pertaining to phosphatases. This remarkable product facilitates the identification and measurement of phosphatase enzymes, pivotal players in diverse cellular mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2616-72-0 |
| Pricing | Inquire |
| Cas | 2616-72-0 |
| Molecular Weight | 391.7 |
| Molecular Formula | C18H15ClNO5P |
| Canonical SMILES | CC1=C(C=CC(=C1)Cl)NC(=O)C2=CC3=CC=CC=C3C=C2OP(=O)(O)O |