(E)-(2-Ethoxyvinyl)boronic Acid Pinacol Ester
trans-2-Ethoxyvinylboronic acid pinacol ester is a boronic ester commonly used in Suzuki-Miyaura cross-coupling.This reaction is a key step to synthesize: Azaindole and diazaindoles from chloroamino-N-heterocycles; Doryanine and its derivatives from 2-bromobenzoic acid.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB004746 |
| Pricing | Inquire |
| Cas | 1201905-61-4 |
| Molecular Weight | 198.07 |
| Molecular Formula | C10H19O3B |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C=COCC |