Apigenin-[d5]
Apigenin-[d5] is the labelled analogue of Apigenin, which is the main active ingredient of Chamomil extract. Chamomile is rich in flavonoid active ingredients, which has antioxidant, anti-angiogenic, anti-inflammatory, anti-allergic and anti-viral effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011786 |
| Pricing | Inquire |
| Cas | 263711-74-6 |
| Molecular Weight | 275.27 |
| Molecular Formula | C15H5D5O5 |
| Canonical SMILES | C1=CC(=CC=C1C2=CC(=C3C(=CC(=CC3=O)O)O2)O)O |